C13H16O2S — CID 61099322
(2,5-dimethylfuran-3-yl)-(5-ethylthiophen-2-yl)methanol (PubChem CID 61099322) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)-(5-ethylthiophen-2-yl)methanol.
| Compound Name | (2,5-dimethylfuran-3-yl)-(5-ethylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 61099322 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)-(5-ethylthiophen-2-yl)methanol |
| SMILES | CCc1ccc(C(O)c2cc(C)oc2C)s1 |
| InChI | InChI=1S/C13H16O2S/c1-4-10-5-6-12(16-10)13(14)11-7-8(2)15-9(11)3/h5-7,13-14H,4H2,1-3H3 |
| InChIKey | YKPWXKFRPYWCQG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |