C13H21NO — CID 104991972
(3-methylcyclohexyl)-(5-methylfuran-2-yl)methanamine (PubChem CID 104991972) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (3-methylcyclohexyl)-(5-methylfuran-2-yl)methanamine.
| Compound Name | (3-methylcyclohexyl)-(5-methylfuran-2-yl)methanamine |
|---|---|
| PubChem CID | 104991972 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3-methylcyclohexyl)-(5-methylfuran-2-yl)methanamine |
| SMILES | Cc1ccc(C(N)C2CCCC(C)C2)o1 |
| InChI | InChI=1S/C13H21NO/c1-9-4-3-5-11(8-9)13(14)12-7-6-10(2)15-12/h6-7,9,11,13H,3-5,8,14H2,1-2H3 |
| InChIKey | PSNODHHUOFDHSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |