C16H27NO — CID 63503968
(4-butylcyclohexyl)-(5-methylfuran-2-yl)methanamine (PubChem CID 63503968) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(5-methylfuran-2-yl)methanamine.
| Compound Name | (4-butylcyclohexyl)-(5-methylfuran-2-yl)methanamine |
|---|---|
| PubChem CID | 63503968 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (4-butylcyclohexyl)-(5-methylfuran-2-yl)methanamine |
| SMILES | CCCCC1CCC(C(N)c2ccc(C)o2)CC1 |
| InChI | InChI=1S/C16H27NO/c1-3-4-5-13-7-9-14(10-8-13)16(17)15-11-6-12(2)18-15/h6,11,13-14,16H,3-5,7-10,17H2,1-2H3 |
| InChIKey | LFPVZOFGMPLNLX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |