C17H29NO — CID 63502788
(4-butylcyclohexyl)-(2,5-dimethylfuran-3-yl)methanamine (PubChem CID 63502788) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(2,5-dimethylfuran-3-yl)methanamine.
| Compound Name | (4-butylcyclohexyl)-(2,5-dimethylfuran-3-yl)methanamine |
|---|---|
| PubChem CID | 63502788 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (4-butylcyclohexyl)-(2,5-dimethylfuran-3-yl)methanamine |
| SMILES | CCCCC1CCC(C(N)c2cc(C)oc2C)CC1 |
| InChI | InChI=1S/C17H29NO/c1-4-5-6-14-7-9-15(10-8-14)17(18)16-11-12(2)19-13(16)3/h11,14-15,17H,4-10,18H2,1-3H3 |
| InChIKey | JMGAKWWWAVRNEW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |