C20H27NO4Si — CID 10499615
methyl 2-[benzyl-(4-oxo-6-trimethylsilylhex-5-ynoyl)amino]propanoate (PubChem CID 10499615) has the molecular formula C20H27NO4Si and a molecular weight of 373.53 g/mol. Its IUPAC name is methyl 2-[benzyl-(4-oxo-6-trimethylsilylhex-5-ynoyl)amino]propanoate.
| Compound Name | methyl 2-[benzyl-(4-oxo-6-trimethylsilylhex-5-ynoyl)amino]propanoate |
|---|---|
| PubChem CID | 10499615 |
| Molecular Formula | C20H27NO4Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | methyl 2-[benzyl-(4-oxo-6-trimethylsilylhex-5-ynoyl)amino]propanoate |
| SMILES | COC(=O)C(C)N(Cc1ccccc1)C(=O)CCC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C20H27NO4Si/c1-16(20(24)25-2)21(15-17-9-7-6-8-10-17)19(23)12-11-18(22)13-14-26(3,4)5/h6-10,16H,11-12,15H2,1-5H3 |
| InChIKey | BMBXHYAPFAMLEJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|