C12H13IN2S — CID 104996961
1-(3-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanamine (PubChem CID 104996961) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 1-(3-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanamine.
| Compound Name | 1-(3-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 104996961 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-(3-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanamine |
| SMILES | Cc1nc(CC(N)c2cccc(I)c2)cs1 |
| InChI | InChI=1S/C12H13IN2S/c1-8-15-11(7-16-8)6-12(14)9-3-2-4-10(13)5-9/h2-5,7,12H,6,14H2,1H3 |
| InChIKey | HXFNZPMVKGWHLS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|