C13H15NO2S — CID 103459359
3-(2-methyl-1,3-thiazol-4-yl)-1-phenylpropane-1,2-diol (PubChem CID 103459359) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-1-phenylpropane-1,2-diol.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 103459359 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-1-phenylpropane-1,2-diol |
| SMILES | Cc1nc(CC(O)C(O)c2ccccc2)cs1 |
| InChI | InChI=1S/C13H15NO2S/c1-9-14-11(8-17-9)7-12(15)13(16)10-5-3-2-4-6-10/h2-6,8,12-13,15-16H,7H2,1H3 |
| InChIKey | BOHVEGNBJGWFIZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |