C12H12ClNOS — CID 62798973
1-(2-chlorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol (PubChem CID 62798973) has the molecular formula C12H12ClNOS and a molecular weight of 253.75 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 62798973 |
| Molecular Formula | C12H12ClNOS |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
| SMILES | Cc1nc(CC(O)c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C12H12ClNOS/c1-8-14-9(7-16-8)6-12(15)10-4-2-3-5-11(10)13/h2-5,7,12,15H,6H2,1H3 |
| InChIKey | QVKJNVYKBGGISP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |