C12H14N2OS — CID 106695570
1-(4-aminophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol (PubChem CID 106695570) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 1-(4-aminophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 106695570 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-(4-aminophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanol |
| SMILES | Cc1nc(CC(O)c2ccc(N)cc2)cs1 |
| InChI | InChI=1S/C12H14N2OS/c1-8-14-11(7-16-8)6-12(15)9-2-4-10(13)5-3-9/h2-5,7,12,15H,6,13H2,1H3 |
| InChIKey | JPSOXWWMGNMHPB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|