C21H25N5S — CID 10499946
N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1H-indazole-3-carbothioamide (PubChem CID 10499946) has the molecular formula C21H25N5S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1H-indazole-3-carbothioamide.
| Compound Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1H-indazole-3-carbothioamide |
|---|---|
| PubChem CID | 10499946 |
| Molecular Formula | C21H25N5S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1H-indazole-3-carbothioamide |
| SMILES | CN1CCN(Cc2ccccc2)CC(NC(=S)c2n[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C21H25N5S/c1-25-11-12-26(13-16-7-3-2-4-8-16)15-17(14-25)22-21(27)20-18-9-5-6-10-19(18)23-24-20/h2-10,17H,11-15H2,1H3,(H,22,27)(H,23,24) |
| InChIKey | DMHJARFNRRVZKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|