C26H33N5O — CID 10670346
N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1-cyclopentylindazole-3-carboxamide (PubChem CID 10670346) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1-cyclopentylindazole-3-carboxamide.
| Compound Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1-cyclopentylindazole-3-carboxamide |
|---|---|
| PubChem CID | 10670346 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-1-cyclopentylindazole-3-carboxamide |
| SMILES | CN1CCN(Cc2ccccc2)CC(NC(=O)c2nn(C3CCCC3)c3ccccc23)C1 |
| InChI | InChI=1S/C26H33N5O/c1-29-15-16-30(17-20-9-3-2-4-10-20)19-21(18-29)27-26(32)25-23-13-7-8-14-24(23)31(28-25)22-11-5-6-12-22/h2-4,7-10,13-14,21-22H,5-6,11-12,15-19H2,1H3,(H,27,32) |
| InChIKey | USYGFGZBAVRWFX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |