C22H27N5O2 — CID 10524628
N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-methoxy-3aH-indazole-3-carboxamide (PubChem CID 10524628) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-methoxy-3aH-indazole-3-carboxamide.
| Compound Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-methoxy-3aH-indazole-3-carboxamide |
|---|---|
| PubChem CID | 10524628 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-(1-benzyl-4-methyl-1,4-diazepan-6-yl)-5-methoxy-3aH-indazole-3-carboxamide |
| SMILES | COC1=CC2C(=NN=C2C(=O)NC2CN(C)CCN(Cc3ccccc3)C2)C=C1 |
| InChI | InChI=1S/C22H27N5O2/c1-26-10-11-27(13-16-6-4-3-5-7-16)15-17(14-26)23-22(28)21-19-12-18(29-2)8-9-20(19)24-25-21/h3-9,12,17,19H,10-11,13-15H2,1-2H3,(H,23,28) |
| InChIKey | CKBHKBKYXHOQBC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |