C12H23NO — CID 105004282
3-methyl-1-(2,4,5-trimethyloxolan-3-yl)but-3-en-1-amine (PubChem CID 105004282) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)but-3-en-1-amine.
| Compound Name | 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 105004282 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)but-3-en-1-amine |
| SMILES | C=C(C)CC(N)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H23NO/c1-7(2)6-11(13)12-8(3)9(4)14-10(12)5/h8-12H,1,6,13H2,2-5H3 |
| InChIKey | TWKJRSPIHKGNNT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|