C9H12ClNS — CID 105005210
1-(5-chlorothiophen-2-yl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 105005210) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005210 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H12ClNS/c1-6(2)9(11-3)7-4-5-8(10)12-7/h4-5,9,11H,1H2,2-3H3 |
| InChIKey | XLEHHPGPBVTXFP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|