C11H19ClN2S — CID 116950192
1-(5-chlorothiophen-2-yl)-1-N,4-dimethylpentane-1,4-diamine (PubChem CID 116950192) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-1-N,4-dimethylpentane-1,4-diamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-1-N,4-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 116950192 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-1-N,4-dimethylpentane-1,4-diamine |
| SMILES | CNC(CCC(C)(C)N)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H19ClN2S/c1-11(2,13)7-6-8(14-3)9-4-5-10(12)15-9/h4-5,8,14H,6-7,13H2,1-3H3 |
| InChIKey | CBPZFVQRJWXASI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |