C17H30N2 — CID 116950190
1-(4-butan-2-ylphenyl)-1-N,4-dimethylpentane-1,4-diamine (PubChem CID 116950190) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-1-N,4-dimethylpentane-1,4-diamine.
| Compound Name | 1-(4-butan-2-ylphenyl)-1-N,4-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 116950190 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-1-N,4-dimethylpentane-1,4-diamine |
| SMILES | CCC(C)c1ccc(C(CCC(C)(C)N)NC)cc1 |
| InChI | InChI=1S/C17H30N2/c1-6-13(2)14-7-9-15(10-8-14)16(19-5)11-12-17(3,4)18/h7-10,13,16,19H,6,11-12,18H2,1-5H3 |
| InChIKey | JUMBZQILHVHNFQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |