C15H26N2 — CID 116950168
1-(4-ethylphenyl)-1-N,4-dimethylpentane-1,4-diamine (PubChem CID 116950168) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-1-N,4-dimethylpentane-1,4-diamine.
| Compound Name | 1-(4-ethylphenyl)-1-N,4-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 116950168 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-(4-ethylphenyl)-1-N,4-dimethylpentane-1,4-diamine |
| SMILES | CCc1ccc(C(CCC(C)(C)N)NC)cc1 |
| InChI | InChI=1S/C15H26N2/c1-5-12-6-8-13(9-7-12)14(17-4)10-11-15(2,3)16/h6-9,14,17H,5,10-11,16H2,1-4H3 |
| InChIKey | HYCILZPFAINPEI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |