C7H10ClNOS — CID 79002149
1-(5-chlorothiophen-2-yl)-2-(methylamino)ethanol (PubChem CID 79002149) has the molecular formula C7H10ClNOS and a molecular weight of 191.68 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 79002149 |
| Molecular Formula | C7H10ClNOS |
| Molecular Weight | 191.68 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H10ClNOS/c1-9-4-5(10)6-2-3-7(8)11-6/h2-3,5,9-10H,4H2,1H3 |
| InChIKey | XQUACYFXSPHROK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |