C7H10ClNO3S2 — CID 82120398
N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]methanesulfonamide (PubChem CID 82120398) has the molecular formula C7H10ClNO3S2 and a molecular weight of 255.75 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]methanesulfonamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]methanesulfonamide |
|---|---|
| PubChem CID | 82120398 |
| Molecular Formula | C7H10ClNO3S2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H10ClNO3S2/c1-14(11,12)9-4-5(10)6-2-3-7(8)13-6/h2-3,5,9-10H,4H2,1H3 |
| InChIKey | ZJJXRZKUFZLLQT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |