C13H11ClFNO2S — CID 94310935
N-[(2S)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-fluorobenzamide (PubChem CID 94310935) has the molecular formula C13H11ClFNO2S and a molecular weight of 299.75 g/mol. Its IUPAC name is N-[(2S)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94310935 |
| Molecular Formula | C13H11ClFNO2S |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-[(2S)-2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-4-fluorobenzamide |
| SMILES | O=C(NC[C@H](O)c1ccc(Cl)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H11ClFNO2S/c14-12-6-5-11(19-12)10(17)7-16-13(18)8-1-3-9(15)4-2-8/h1-6,10,17H,7H2,(H,16,18)/t10-/m0/s1 |
| InChIKey | QBLQOASGKSJFFP-JTQLQIEISA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |