C13H14ClNO3S — CID 71989468
N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-5-ethylfuran-2-carboxamide (PubChem CID 71989468) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-5-ethylfuran-2-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-5-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 71989468 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-5-ethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NCC(O)c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C13H14ClNO3S/c1-2-8-3-4-10(18-8)13(17)15-7-9(16)11-5-6-12(14)19-11/h3-6,9,16H,2,7H2,1H3,(H,15,17) |
| InChIKey | VPJUDVUETDYGBA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |