C13H25N — CID 105005566
N-ethyl-2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-2-en-1-amine (PubChem CID 105005566) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N-ethyl-2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-2-en-1-amine.
| Compound Name | N-ethyl-2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 105005566 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-ethyl-2-methyl-1-(2,2,3,3-tetramethylcyclopropyl)prop-2-en-1-amine |
| SMILES | C=C(C)C(NCC)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H25N/c1-8-14-10(9(2)3)11-12(4,5)13(11,6)7/h10-11,14H,2,8H2,1,3-7H3 |
| InChIKey | WSZOTUBWAWOFFW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|