About 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine
2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine (PubChem CID 105008598) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine |
| PubChem CID | 105008598 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine |
| SMILES | CCCOCC(N)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H25NO2/c1-5-6-14-7-11(13)12-8(2)9(3)15-10(12)4/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | AKUYHHFLTMAESM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The IUPAC name of 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine (CID 105008598) is 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine.
What is the SMILES notation for 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The canonical SMILES for 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine is CCCOCC(N)C1C(C)OC(C)C1C.
What is the InChIKey of 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
The InChIKey is AKUYHHFLTMAESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-5-6-14-7-11(13)12-8(2)9(3)15-10(12)4/h8-12H,5-7,13H2,1-4H3.
What are the key properties of 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine?
2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine has a molecular weight of 215.34 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-1-(2,4,5-trimethyloxolan-3-yl)ethanamine is sourced from PubChem (CID 105008598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).