C16H31NO — CID 114193118
3-cyclohexyl-1-(2,4,5-trimethyloxolan-3-yl)propan-1-amine (PubChem CID 114193118) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,4,5-trimethyloxolan-3-yl)propan-1-amine.
| Compound Name | 3-cyclohexyl-1-(2,4,5-trimethyloxolan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 114193118 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 3-cyclohexyl-1-(2,4,5-trimethyloxolan-3-yl)propan-1-amine |
| SMILES | CC1OC(C)C(C(N)CCC2CCCCC2)C1C |
| InChI | InChI=1S/C16H31NO/c1-11-12(2)18-13(3)16(11)15(17)10-9-14-7-5-4-6-8-14/h11-16H,4-10,17H2,1-3H3 |
| InChIKey | BFEOTTXGIAOWJH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |