C14H20BrN3S — CID 105009218
N-[1-(3-bromothiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]propan-1-amine (PubChem CID 105009218) has the molecular formula C14H20BrN3S and a molecular weight of 342.31 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105009218 |
| Molecular Formula | C14H20BrN3S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)-2-(1-ethylimidazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1nccn1CC)c1sccc1Br |
| InChI | InChI=1S/C14H20BrN3S/c1-3-6-16-12(14-11(15)5-9-19-14)10-13-17-7-8-18(13)4-2/h5,7-9,12,16H,3-4,6,10H2,1-2H3 |
| InChIKey | VFSDCVIFQPWZOF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |