C11H19NO2S — CID 105013504
1-(4-methoxythiophen-2-yl)-N-methyl-2-propan-2-yloxyethanamine (PubChem CID 105013504) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 1-(4-methoxythiophen-2-yl)-N-methyl-2-propan-2-yloxyethanamine.
| Compound Name | 1-(4-methoxythiophen-2-yl)-N-methyl-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 105013504 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-(4-methoxythiophen-2-yl)-N-methyl-2-propan-2-yloxyethanamine |
| SMILES | CNC(COC(C)C)c1cc(OC)cs1 |
| InChI | InChI=1S/C11H19NO2S/c1-8(2)14-6-10(12-3)11-5-9(13-4)7-15-11/h5,7-8,10,12H,6H2,1-4H3 |
| InChIKey | HMJNMXVOMIOSIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |