C12H15NO2S — CID 105030240
2-(furan-3-yl)-1-(4-methoxythiophen-2-yl)-N-methylethanamine (PubChem CID 105030240) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-(4-methoxythiophen-2-yl)-N-methylethanamine.
| Compound Name | 2-(furan-3-yl)-1-(4-methoxythiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105030240 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(furan-3-yl)-1-(4-methoxythiophen-2-yl)-N-methylethanamine |
| SMILES | CNC(Cc1ccoc1)c1cc(OC)cs1 |
| InChI | InChI=1S/C12H15NO2S/c1-13-11(5-9-3-4-15-7-9)12-6-10(14-2)8-16-12/h3-4,6-8,11,13H,5H2,1-2H3 |
| InChIKey | NRRRCBDVEYRHMM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |