C11H19NOS — CID 105017620
1-(4-methoxythiophen-2-yl)-N,2-dimethylbutan-1-amine (PubChem CID 105017620) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 1-(4-methoxythiophen-2-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(4-methoxythiophen-2-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105017620 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(4-methoxythiophen-2-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)C(NC)c1cc(OC)cs1 |
| InChI | InChI=1S/C11H19NOS/c1-5-8(2)11(12-3)10-6-9(13-4)7-14-10/h6-8,11-12H,5H2,1-4H3 |
| InChIKey | JUPZLRHEDHAQHT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |