C15H25NO2 — CID 105013578
1-(3,5-dimethoxyphenyl)-N,2,3-trimethylbutan-1-amine (PubChem CID 105013578) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-N,2,3-trimethylbutan-1-amine.
| Compound Name | 1-(3,5-dimethoxyphenyl)-N,2,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 105013578 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-N,2,3-trimethylbutan-1-amine |
| SMILES | CNC(c1cc(OC)cc(OC)c1)C(C)C(C)C |
| InChI | InChI=1S/C15H25NO2/c1-10(2)11(3)15(16-4)12-7-13(17-5)9-14(8-12)18-6/h7-11,15-16H,1-6H3 |
| InChIKey | PXWKIIBCZMWHHT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |