C17H29NO3 — CID 105013814
N,2-diethyl-1-(3,4,5-trimethoxyphenyl)butan-1-amine (PubChem CID 105013814) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is N,2-diethyl-1-(3,4,5-trimethoxyphenyl)butan-1-amine.
| Compound Name | N,2-diethyl-1-(3,4,5-trimethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 105013814 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N,2-diethyl-1-(3,4,5-trimethoxyphenyl)butan-1-amine |
| SMILES | CCNC(c1cc(OC)c(OC)c(OC)c1)C(CC)CC |
| InChI | InChI=1S/C17H29NO3/c1-7-12(8-2)16(18-9-3)13-10-14(19-4)17(21-6)15(11-13)20-5/h10-12,16,18H,7-9H2,1-6H3 |
| InChIKey | YKENUKPIIJLMKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |