C9H16F3NO2S — CID 105014137
2,2,2-trifluoro-1-(3-methylsulfonylcyclohexyl)ethanamine (PubChem CID 105014137) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-methylsulfonylcyclohexyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-1-(3-methylsulfonylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 105014137 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-methylsulfonylcyclohexyl)ethanamine |
| SMILES | CS(=O)(=O)C1CCCC(C(N)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO2S/c1-16(14,15)7-4-2-3-6(5-7)8(13)9(10,11)12/h6-8H,2-5,13H2,1H3 |
| InChIKey | YQMFICYNHNQVFF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |