C15H17BrFNS — CID 105015574
2-(3-bromo-5-fluorophenyl)-1-(5-ethylthiophen-2-yl)-N-methylethanamine (PubChem CID 105015574) has the molecular formula C15H17BrFNS and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(5-ethylthiophen-2-yl)-N-methylethanamine.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(5-ethylthiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105015574 |
| Molecular Formula | C15H17BrFNS |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(5-ethylthiophen-2-yl)-N-methylethanamine |
| SMILES | CCc1ccc(C(Cc2cc(F)cc(Br)c2)NC)s1 |
| InChI | InChI=1S/C15H17BrFNS/c1-3-13-4-5-15(19-13)14(18-2)8-10-6-11(16)9-12(17)7-10/h4-7,9,14,18H,3,8H2,1-2H3 |
| InChIKey | UGQWYGJYOPTTSC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |