C16H21IN2S — CID 105015883
2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 105015883) has the molecular formula C16H21IN2S and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105015883 |
| Molecular Formula | C16H21IN2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1nc(C(C)(C)C)cs1)c1ccccc1I |
| InChI | InChI=1S/C16H21IN2S/c1-16(2,3)14-10-20-15(19-14)9-13(18-4)11-7-5-6-8-12(11)17/h5-8,10,13,18H,9H2,1-4H3 |
| InChIKey | NHWHPJDRUMQVOU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|