C9H21NO2S — CID 105017427
2,4-dimethyl-2-methylsulfonylhexan-3-amine (PubChem CID 105017427) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is 2,4-dimethyl-2-methylsulfonylhexan-3-amine.
| Compound Name | 2,4-dimethyl-2-methylsulfonylhexan-3-amine |
|---|---|
| PubChem CID | 105017427 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2,4-dimethyl-2-methylsulfonylhexan-3-amine |
| SMILES | CCC(C)C(N)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H21NO2S/c1-6-7(2)8(10)9(3,4)13(5,11)12/h7-8H,6,10H2,1-5H3 |
| InChIKey | OGQVBBOPDFGDEC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |