C10H23NO2S — CID 114978377
N-ethyl-2,4-dimethyl-2-methylsulfonylpentan-3-amine (PubChem CID 114978377) has the molecular formula C10H23NO2S and a molecular weight of 221.37 g/mol. Its IUPAC name is N-ethyl-2,4-dimethyl-2-methylsulfonylpentan-3-amine.
| Compound Name | N-ethyl-2,4-dimethyl-2-methylsulfonylpentan-3-amine |
|---|---|
| PubChem CID | 114978377 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-ethyl-2,4-dimethyl-2-methylsulfonylpentan-3-amine |
| SMILES | CCNC(C(C)C)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H23NO2S/c1-7-11-9(8(2)3)10(4,5)14(6,12)13/h8-9,11H,7H2,1-6H3 |
| InChIKey | ZCDBAGXZAKSCDX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |