C11H25NO2S — CID 105017343
N-ethyl-2,4-dimethyl-2-methylsulfonylhexan-3-amine (PubChem CID 105017343) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is N-ethyl-2,4-dimethyl-2-methylsulfonylhexan-3-amine.
| Compound Name | N-ethyl-2,4-dimethyl-2-methylsulfonylhexan-3-amine |
|---|---|
| PubChem CID | 105017343 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-ethyl-2,4-dimethyl-2-methylsulfonylhexan-3-amine |
| SMILES | CCNC(C(C)CC)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H25NO2S/c1-7-9(3)10(12-8-2)11(4,5)15(6,13)14/h9-10,12H,7-8H2,1-6H3 |
| InChIKey | KXXJKHKCBUXSIM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |