C9H12N4O2 — CID 105023328
1-methyl-3-[(5-oxopyrrolidin-3-yl)amino]pyrazin-2-one (PubChem CID 105023328) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-methyl-3-[(5-oxopyrrolidin-3-yl)amino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[(5-oxopyrrolidin-3-yl)amino]pyrazin-2-one |
|---|---|
| PubChem CID | 105023328 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-methyl-3-[(5-oxopyrrolidin-3-yl)amino]pyrazin-2-one |
| SMILES | Cn1ccnc(NC2CNC(=O)C2)c1=O |
| InChI | InChI=1S/C9H12N4O2/c1-13-3-2-10-8(9(13)15)12-6-4-7(14)11-5-6/h2-3,6H,4-5H2,1H3,(H,10,12)(H,11,14) |
| InChIKey | OKJVQNSVZNEIHD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |