C19H28N7O3- — CID 142038972
[3-imino-1-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]butan-2-ylidene]azanide (PubChem CID 142038972) has the molecular formula C19H28N7O3- and a molecular weight of 402.48 g/mol. Its IUPAC name is [3-imino-1-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]butan-2-ylidene]azanide.
| Compound Name | [3-imino-1-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]butan-2-ylidene]azanide |
|---|---|
| PubChem CID | 142038972 |
| Molecular Formula | C19H28N7O3- |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [3-imino-1-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]butan-2-ylidene]azanide |
| SMILES | [H]/N=C(\C)C(=[N-])CNc1nccn([C@@H](CC)C(=O)NCC(=O)CN2CCCC2)c1=O |
| InChI | InChI=1S/C19H28N7O3/c1-3-16(18(28)24-10-14(27)12-25-7-4-5-8-25)26-9-6-22-17(19(26)29)23-11-15(21)13(2)20/h6,9,16,20H,3-5,7-8,10-12H2,1-2H3,(H,22,23)(H,24,28)/q-1/b20-13+/t16-/m0/s1 |
| InChIKey | SBMURTOVCSSLSY-UOEVCUDDSA-N |
| XLogP | 0.44 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|