C21H32N7O3- — CID 142039138
[4-imino-6-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]hexan-3-ylidene]azanide (PubChem CID 142039138) has the molecular formula C21H32N7O3- and a molecular weight of 430.53 g/mol. Its IUPAC name is [4-imino-6-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]hexan-3-ylidene]azanide.
| Compound Name | [4-imino-6-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]hexan-3-ylidene]azanide |
|---|---|
| PubChem CID | 142039138 |
| Molecular Formula | C21H32N7O3- |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [4-imino-6-[[3-oxo-4-[(2S)-1-oxo-1-[(2-oxo-3-pyrrolidin-1-ylpropyl)amino]butan-2-yl]pyrazin-2-yl]amino]hexan-3-ylidene]azanide |
| SMILES | [H]/N=C(/CCNc1nccn(C(CC)C(=O)NCC(=O)CN2CCCC2)c1=O)C(=[N-])CC |
| InChI | InChI=1S/C21H32N7O3/c1-3-16(22)17(23)7-8-24-19-21(31)28(12-9-25-19)18(4-2)20(30)26-13-15(29)14-27-10-5-6-11-27/h9,12,18,23H,3-8,10-11,13-14H2,1-2H3,(H,24,25)(H,26,30)/q-1/b23-17- |
| InChIKey | HSVXQSFMRIHBSF-QJOMJCCJSA-N |
| XLogP | 1.22 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|