C15H29N6O2+ — CID 159179463
(2S)-2,6-diamino-1-[1-[(2S)-2,6-diaminohexanoyl]-1H-imidazol-1-ium-2-yl]hexan-1-one (PubChem CID 159179463) has the molecular formula C15H29N6O2+ and a molecular weight of 325.44 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[1-[(2S)-2,6-diaminohexanoyl]-1H-imidazol-1-ium-2-yl]hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-[1-[(2S)-2,6-diaminohexanoyl]-1H-imidazol-1-ium-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 159179463 |
| Molecular Formula | C15H29N6O2+ |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (2S)-2,6-diamino-1-[1-[(2S)-2,6-diaminohexanoyl]-1H-imidazol-1-ium-2-yl]hexan-1-one |
| SMILES | NCCCC[C@H](N)C(=O)C1=NC=C[NH+]1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H28N6O2/c16-7-3-1-5-11(18)13(22)14-20-9-10-21(14)15(23)12(19)6-2-4-8-17/h9-12H,1-8,16-19H2/p+1/t11-,12-/m0/s1 |
| InChIKey | KMRXBQZELIYYKY-RYUDHWBXSA-O |
| XLogP | -2.24 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|