C21H33N7O3 — CID 142039139
(2S)-2-[3-(3,4-diiminohexylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide (PubChem CID 142039139) has the molecular formula C21H33N7O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (2S)-2-[3-(3,4-diiminohexylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide.
| Compound Name | (2S)-2-[3-(3,4-diiminohexylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 142039139 |
| Molecular Formula | C21H33N7O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (2S)-2-[3-(3,4-diiminohexylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
| SMILES | [H]/N=C(CCNc1nccn([C@@H](CC)C(=O)NCC(=O)CN2CCCC2)c1=O)\C(CC)=N\[H] |
| InChI | InChI=1S/C21H33N7O3/c1-3-16(22)17(23)7-8-24-19-21(31)28(12-9-25-19)18(4-2)20(30)26-13-15(29)14-27-10-5-6-11-27/h9,12,18,22-23H,3-8,10-11,13-14H2,1-2H3,(H,24,25)(H,26,30)/b22-16+,23-17-/t18-/m0/s1 |
| InChIKey | BIJCUVJOIMFTRL-QAJAGOQESA-N |
| XLogP | 1.23 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|