C22H34N8O3 — CID 142039050
N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide (PubChem CID 142039050) has the molecular formula C22H34N8O3 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide.
| Compound Name | N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide |
|---|---|
| PubChem CID | 142039050 |
| Molecular Formula | C22H34N8O3 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-oxopropyl]-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanamide |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NCC(=O)CN2CCN3CCCC3C2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C22H34N8O3/c1-3-19(30-8-6-25-20(22(30)33)26-12-18(24)15(2)23)21(32)27-11-17(31)14-28-9-10-29-7-4-5-16(29)13-28/h6,8,16,19,23-24H,3-5,7,9-14H2,1-2H3,(H,25,26)(H,27,32)/b23-15+,24-18- |
| InChIKey | DHZJKVQIDIFCFK-YPTSKYFGSA-N |
| XLogP | 0.13 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|