C19H29N7O3 — CID 142038973
(2S)-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide (PubChem CID 142038973) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is (2S)-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide.
| Compound Name | (2S)-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 142038973 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (2S)-2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]-N-(2-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NCC(=O)CN2CCCC2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C19H29N7O3/c1-3-16(18(28)24-10-14(27)12-25-7-4-5-8-25)26-9-6-22-17(19(26)29)23-11-15(21)13(2)20/h6,9,16,20-21H,3-5,7-8,10-12H2,1-2H3,(H,22,23)(H,24,28)/b20-13+,21-15- |
| InChIKey | DDEAFHRRVLOQRU-PLVHLWNTSA-N |
| XLogP | 0.45 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|