C12H18N4O2 — CID 22969726
1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-2-one (PubChem CID 22969726) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 22969726 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrazin-2-one |
| SMILES | Cn1ccnc(NCCCN2CCCC2=O)c1=O |
| InChI | InChI=1S/C12H18N4O2/c1-15-9-6-14-11(12(15)18)13-5-3-8-16-7-2-4-10(16)17/h6,9H,2-5,7-8H2,1H3,(H,13,14) |
| InChIKey | NDUNRPWJKPWVTB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|