C8H11N3O — CID 173471230
1-(1,2-dihydropyrazin-3-yl)pyrrolidin-2-one (PubChem CID 173471230) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-(1,2-dihydropyrazin-3-yl)pyrrolidin-2-one.
| Compound Name | 1-(1,2-dihydropyrazin-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 173471230 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-(1,2-dihydropyrazin-3-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1=NC=CNC1 |
| InChI | InChI=1S/C8H11N3O/c12-8-2-1-5-11(8)7-6-9-3-4-10-7/h3-4,9H,1-2,5-6H2 |
| InChIKey | CKMZTHDRPBOLEE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |