C23H35N8O3- — CID 142039136
[1-[[4-[1-[[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxopropyl]amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-iminobutan-2-ylidene]azanide (PubChem CID 142039136) has the molecular formula C23H35N8O3- and a molecular weight of 471.59 g/mol. Its IUPAC name is [1-[[4-[1-[[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxopropyl]amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-iminobutan-2-ylidene]azanide.
| Compound Name | [1-[[4-[1-[[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxopropyl]amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-iminobutan-2-ylidene]azanide |
|---|---|
| PubChem CID | 142039136 |
| Molecular Formula | C23H35N8O3- |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | [1-[[4-[1-[[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-oxopropyl]amino]-1-oxobutan-2-yl]-3-oxopyrazin-2-yl]amino]-3-iminobutan-2-ylidene]azanide |
| SMILES | [H]/N=C(\C)C(=[N-])CNc1nccn(C(CC)C(=O)NCC(=O)CN2CCN3CCCCC3C2)c1=O |
| InChI | InChI=1S/C23H35N8O3/c1-3-20(31-9-7-26-21(23(31)34)27-13-19(25)16(2)24)22(33)28-12-18(32)15-29-10-11-30-8-5-4-6-17(30)14-29/h7,9,17,20,24H,3-6,8,10-15H2,1-2H3,(H,26,27)(H,28,33)/q-1/b24-16+ |
| InChIKey | RBTGTFFWZYHQES-LFVJCYFKSA-N |
| XLogP | 0.51 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|