C16H19N3OS — CID 105023564
2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(3-propoxyphenyl)ethanamine (PubChem CID 105023564) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(3-propoxyphenyl)ethanamine.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(3-propoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 105023564 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(3-propoxyphenyl)ethanamine |
| SMILES | CCCOc1cccc(C(N)Cc2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C16H19N3OS/c1-2-7-20-14-5-3-4-12(9-14)15(17)10-13-11-19-6-8-21-16(19)18-13/h3-6,8-9,11,15H,2,7,10,17H2,1H3 |
| InChIKey | QLPCHLIBFLMNKS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |