C10H14F3NOS — CID 105024285
5,5,5-trifluoro-1-(4-methoxythiophen-2-yl)pentan-1-amine (PubChem CID 105024285) has the molecular formula C10H14F3NOS and a molecular weight of 253.29 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(4-methoxythiophen-2-yl)pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-1-(4-methoxythiophen-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 105024285 |
| Molecular Formula | C10H14F3NOS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5,5,5-trifluoro-1-(4-methoxythiophen-2-yl)pentan-1-amine |
| SMILES | COc1csc(C(N)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H14F3NOS/c1-15-7-5-9(16-6-7)8(14)3-2-4-10(11,12)13/h5-6,8H,2-4,14H2,1H3 |
| InChIKey | ZNNPZCOTMQIDRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |