C24H46O4Si — CID 10502568
(3S,4R,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-4-hydroxy-3,5,5-trimethyloxan-2-one (PubChem CID 10502568) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (3S,4R,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-4-hydroxy-3,5,5-trimethyloxan-2-one.
| Compound Name | (3S,4R,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-4-hydroxy-3,5,5-trimethyloxan-2-one |
|---|---|
| PubChem CID | 10502568 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (3S,4R,6R)-6-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxydec-2-en-2-yl]-4-hydroxy-3,5,5-trimethyloxan-2-one |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@H]1OC(=O)[C@@H](C)[C@@H](O)C1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O4Si/c1-11-12-13-14-19(28-29(9,10)23(4,5)6)16-15-17(2)21-24(7,8)20(25)18(3)22(26)27-21/h15,18-21,25H,11-14,16H2,1-10H3/b17-15+/t18-,19+,20+,21+/m0/s1 |
| InChIKey | IWVFNHDKJADUMI-BRMMHRSKSA-N |
| XLogP | 6.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|