C13H14Br2N2OS — CID 105026739
(4,5-dibromothiophen-2-yl)-(5-propoxy-3-pyridinyl)methanamine (PubChem CID 105026739) has the molecular formula C13H14Br2N2OS and a molecular weight of 406.14 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(5-propoxy-3-pyridinyl)methanamine.
| Compound Name | (4,5-dibromothiophen-2-yl)-(5-propoxy-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 105026739 |
| Molecular Formula | C13H14Br2N2OS |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(5-propoxy-3-pyridinyl)methanamine |
| SMILES | CCCOc1cncc(C(N)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C13H14Br2N2OS/c1-2-3-18-9-4-8(6-17-7-9)12(16)11-5-10(14)13(15)19-11/h4-7,12H,2-3,16H2,1H3 |
| InChIKey | POODFVGPRMAZEY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |